C13H11F7N2O3S — CID 126369506
N'-[(E)-5,5,6,6,7,7,7-heptafluoro-4-oxohept-2-en-2-yl]benzenesulfonohydrazide (PubChem CID 126369506) has the molecular formula C13H11F7N2O3S and a molecular weight of 408.30 g/mol. Its IUPAC name is N'-[(E)-5,5,6,6,7,7,7-heptafluoro-4-oxohept-2-en-2-yl]benzenesulfonohydrazide.
| Compound Name | N'-[(E)-5,5,6,6,7,7,7-heptafluoro-4-oxohept-2-en-2-yl]benzenesulfonohydrazide |
|---|---|
| PubChem CID | 126369506 |
| Molecular Formula | C13H11F7N2O3S |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | N'-[(E)-5,5,6,6,7,7,7-heptafluoro-4-oxohept-2-en-2-yl]benzenesulfonohydrazide |
| SMILES | C/C(=C\C(=O)C(F)(F)C(F)(F)C(F)(F)F)NNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H11F7N2O3S/c1-8(21-22-26(24,25)9-5-3-2-4-6-9)7-10(23)11(14,15)12(16,17)13(18,19)20/h2-7,21-22H,1H3/b8-7+ |
| InChIKey | YOYHOHXTVAYBMS-BQYQJAHWSA-N |
| XLogP | 2.78 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|