C11H9F5N2O3 — CID 6386891
N'-[(E)-5,5,6,6,6-pentafluoro-4-oxohex-2-en-2-yl]furan-2-carbohydrazide (PubChem CID 6386891) has the molecular formula C11H9F5N2O3 and a molecular weight of 312.19 g/mol. Its IUPAC name is N'-[(E)-5,5,6,6,6-pentafluoro-4-oxohex-2-en-2-yl]furan-2-carbohydrazide.
| Compound Name | N'-[(E)-5,5,6,6,6-pentafluoro-4-oxohex-2-en-2-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 6386891 |
| Molecular Formula | C11H9F5N2O3 |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | N'-[(E)-5,5,6,6,6-pentafluoro-4-oxohex-2-en-2-yl]furan-2-carbohydrazide |
| SMILES | C/C(=C\C(=O)C(F)(F)C(F)(F)F)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C11H9F5N2O3/c1-6(5-8(19)10(12,13)11(14,15)16)17-18-9(20)7-3-2-4-21-7/h2-5,17H,1H3,(H,18,20)/b6-5+ |
| InChIKey | ZOSGBHRTPQHYJG-AATRIKPKSA-N |
| XLogP | 2.18 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|