C13H10F7N3O2 — CID 5369919
N'-[(E)-5,5,6,6,7,7,7-heptafluoro-4-oxohept-2-en-2-yl]pyridine-3-carbohydrazide (PubChem CID 5369919) has the molecular formula C13H10F7N3O2 and a molecular weight of 373.23 g/mol. Its IUPAC name is N'-[(E)-5,5,6,6,7,7,7-heptafluoro-4-oxohept-2-en-2-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[(E)-5,5,6,6,7,7,7-heptafluoro-4-oxohept-2-en-2-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 5369919 |
| Molecular Formula | C13H10F7N3O2 |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | N'-[(E)-5,5,6,6,7,7,7-heptafluoro-4-oxohept-2-en-2-yl]pyridine-3-carbohydrazide |
| SMILES | C/C(=C\C(=O)C(F)(F)C(F)(F)C(F)(F)F)NNC(=O)c1cccnc1 |
| InChI | InChI=1S/C13H10F7N3O2/c1-7(22-23-10(25)8-3-2-4-21-6-8)5-9(24)11(14,15)12(16,17)13(18,19)20/h2-6,22H,1H3,(H,23,25)/b7-5+ |
| InChIKey | FDUFLKYKEKIYCE-FNORWQNLSA-N |
| XLogP | 2.62 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|