C20H19F3O5S3 — CID 174583563
4-methylsulfonyl-1,2-diphenylbenzene;sulfane;trifluoromethanesulfonic acid (PubChem CID 174583563) has the molecular formula C20H19F3O5S3 and a molecular weight of 492.56 g/mol. Its IUPAC name is 4-methylsulfonyl-1,2-diphenylbenzene;sulfane;trifluoromethanesulfonic acid.
| Compound Name | 4-methylsulfonyl-1,2-diphenylbenzene;sulfane;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 174583563 |
| Molecular Formula | C20H19F3O5S3 |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | 4-methylsulfonyl-1,2-diphenylbenzene;sulfane;trifluoromethanesulfonic acid |
| SMILES | CS(=O)(=O)c1ccc(-c2ccccc2)c(-c2ccccc2)c1.O=S(=O)(O)C(F)(F)F.S |
| InChI | InChI=1S/C19H16O2S.CHF3O3S.H2S/c1-22(20,21)17-12-13-18(15-8-4-2-5-9-15)19(14-17)16-10-6-3-7-11-16;2-1(3,4)8(5,6)7;/h2-14H,1H3;(H,5,6,7);1H2 |
| InChIKey | BKGIUWJFTKYFCH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|