C26H25F3O4S — CID 68851674
4-methyl-2-[4-(4-methylsulfonylphenyl)-5-phenyl-2-(trifluoromethyl)phenyl]pentanoic acid (PubChem CID 68851674) has the molecular formula C26H25F3O4S and a molecular weight of 490.54 g/mol. Its IUPAC name is 4-methyl-2-[4-(4-methylsulfonylphenyl)-5-phenyl-2-(trifluoromethyl)phenyl]pentanoic acid.
| Compound Name | 4-methyl-2-[4-(4-methylsulfonylphenyl)-5-phenyl-2-(trifluoromethyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 68851674 |
| Molecular Formula | C26H25F3O4S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 4-methyl-2-[4-(4-methylsulfonylphenyl)-5-phenyl-2-(trifluoromethyl)phenyl]pentanoic acid |
| SMILES | CC(C)CC(C(=O)O)c1cc(-c2ccccc2)c(-c2ccc(S(C)(=O)=O)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C26H25F3O4S/c1-16(2)13-23(25(30)31)22-14-20(17-7-5-4-6-8-17)21(15-24(22)26(27,28)29)18-9-11-19(12-10-18)34(3,32)33/h4-12,14-16,23H,13H2,1-3H3,(H,30,31) |
| InChIKey | LLFJZFMHLLWCCJ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |