C27H25F3O2 — CID 89423613
4-methyl-2-[3-[(Z)-2-phenylethenyl]-5-[4-(trifluoromethyl)phenyl]phenyl]pentanoic acid (PubChem CID 89423613) has the molecular formula C27H25F3O2 and a molecular weight of 438.49 g/mol. Its IUPAC name is 4-methyl-2-[3-[(Z)-2-phenylethenyl]-5-[4-(trifluoromethyl)phenyl]phenyl]pentanoic acid.
| Compound Name | 4-methyl-2-[3-[(Z)-2-phenylethenyl]-5-[4-(trifluoromethyl)phenyl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 89423613 |
| Molecular Formula | C27H25F3O2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 4-methyl-2-[3-[(Z)-2-phenylethenyl]-5-[4-(trifluoromethyl)phenyl]phenyl]pentanoic acid |
| SMILES | CC(C)CC(C(=O)O)c1cc(/C=C\c2ccccc2)cc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C27H25F3O2/c1-18(2)14-25(26(31)32)23-16-20(9-8-19-6-4-3-5-7-19)15-22(17-23)21-10-12-24(13-11-21)27(28,29)30/h3-13,15-18,25H,14H2,1-2H3,(H,31,32)/b9-8- |
| InChIKey | CCOGGZDXPUNQSD-HJWRWDBZSA-N |
| XLogP | 7.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|