C26H21F4NO2 — CID 59004792
2-[3-(3-cyano-4-fluorophenyl)-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid (PubChem CID 59004792) has the molecular formula C26H21F4NO2 and a molecular weight of 455.45 g/mol. Its IUPAC name is 2-[3-(3-cyano-4-fluorophenyl)-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid.
| Compound Name | 2-[3-(3-cyano-4-fluorophenyl)-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 59004792 |
| Molecular Formula | C26H21F4NO2 |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 2-[3-(3-cyano-4-fluorophenyl)-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)c1cc(-c2ccc(C(F)(F)F)cc2)cc(-c2ccc(F)c(C#N)c2)c1 |
| InChI | InChI=1S/C26H21F4NO2/c1-15(2)9-23(25(32)33)20-12-18(16-3-6-22(7-4-16)26(28,29)30)11-19(13-20)17-5-8-24(27)21(10-17)14-31/h3-8,10-13,15,23H,9H2,1-2H3,(H,32,33) |
| InChIKey | UZRYIQNIRXQGMX-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |