C26H23ClF3NO3 — CID 89423604
2-[3-(3-amino-5-chlorobenzoyl)-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid (PubChem CID 89423604) has the molecular formula C26H23ClF3NO3 and a molecular weight of 489.92 g/mol. Its IUPAC name is 2-[3-(3-amino-5-chlorobenzoyl)-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid.
| Compound Name | 2-[3-(3-amino-5-chlorobenzoyl)-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 89423604 |
| Molecular Formula | C26H23ClF3NO3 |
| Molecular Weight | 489.92 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 2-[3-(3-amino-5-chlorobenzoyl)-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)c1cc(C(=O)c2cc(N)cc(Cl)c2)cc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C26H23ClF3NO3/c1-14(2)7-23(25(33)34)17-8-16(15-3-5-20(6-4-15)26(28,29)30)9-18(10-17)24(32)19-11-21(27)13-22(31)12-19/h3-6,8-14,23H,7,31H2,1-2H3,(H,33,34) |
| InChIKey | VOAMJFBBJBZOCT-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.92 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|