C27H26F3NO2 — CID 89423606
2-[3-(4-aminophenyl)-5-[(Z)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]-4-methylpentanoic acid (PubChem CID 89423606) has the molecular formula C27H26F3NO2 and a molecular weight of 453.50 g/mol. Its IUPAC name is 2-[3-(4-aminophenyl)-5-[(Z)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]-4-methylpentanoic acid.
| Compound Name | 2-[3-(4-aminophenyl)-5-[(Z)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 89423606 |
| Molecular Formula | C27H26F3NO2 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 2-[3-(4-aminophenyl)-5-[(Z)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)c1cc(/C=C\c2ccc(C(F)(F)F)cc2)cc(-c2ccc(N)cc2)c1 |
| InChI | InChI=1S/C27H26F3NO2/c1-17(2)13-25(26(32)33)22-15-19(14-21(16-22)20-7-11-24(31)12-8-20)4-3-18-5-9-23(10-6-18)27(28,29)30/h3-12,14-17,25H,13,31H2,1-2H3,(H,32,33)/b4-3- |
| InChIKey | ULKAZANYGJOHRA-ARJAWSKDSA-N |
| XLogP | 7.34 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|