C28H24F6O2 — CID 74440806
4-methyl-2-[3-[4-(trifluoromethyl)phenyl]-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]pentanoic acid (PubChem CID 74440806) has the molecular formula C28H24F6O2 and a molecular weight of 506.49 g/mol. Its IUPAC name is 4-methyl-2-[3-[4-(trifluoromethyl)phenyl]-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]pentanoic acid.
| Compound Name | 4-methyl-2-[3-[4-(trifluoromethyl)phenyl]-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 74440806 |
| Molecular Formula | C28H24F6O2 |
| Molecular Weight | 506.49 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 4-methyl-2-[3-[4-(trifluoromethyl)phenyl]-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]pentanoic acid |
| SMILES | CC(C)CC(C(=O)O)c1cc(C=Cc2ccc(C(F)(F)F)cc2)cc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C28H24F6O2/c1-17(2)13-25(26(35)36)22-15-19(4-3-18-5-9-23(10-6-18)27(29,30)31)14-21(16-22)20-7-11-24(12-8-20)28(32,33)34/h3-12,14-17,25H,13H2,1-2H3,(H,35,36) |
| InChIKey | TXWOUBLTEYABGN-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.49 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|