C26H22F5O3+ — CID 163515350
[2-[3-(3,5-difluorobenzoyl)-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoyl]oxidanium (PubChem CID 163515350) has the molecular formula C26H22F5O3+ and a molecular weight of 477.45 g/mol. Its IUPAC name is [2-[3-(3,5-difluorobenzoyl)-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoyl]oxidanium.
| Compound Name | [2-[3-(3,5-difluorobenzoyl)-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoyl]oxidanium |
|---|---|
| PubChem CID | 163515350 |
| Molecular Formula | C26H22F5O3+ |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | [2-[3-(3,5-difluorobenzoyl)-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoyl]oxidanium |
| SMILES | CC(C)CC(C(=O)[OH2+])c1cc(C(=O)c2cc(F)cc(F)c2)cc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C26H21F5O3/c1-14(2)7-23(25(33)34)17-8-16(15-3-5-20(6-4-15)26(29,30)31)9-18(10-17)24(32)19-11-21(27)13-22(28)12-19/h3-6,8-14,23H,7H2,1-2H3,(H,33,34)/p+1 |
| InChIKey | DGFPMIWBNSXYHA-UHFFFAOYSA-O |
| XLogP | 6.26 |
| TPSA | 57.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|