C26H24F5O2+ — CID 163451143
[2-[3-[(2,4-difluorophenyl)methyl]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoyl]oxidanium (PubChem CID 163451143) has the molecular formula C26H24F5O2+ and a molecular weight of 463.47 g/mol. Its IUPAC name is [2-[3-[(2,4-difluorophenyl)methyl]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoyl]oxidanium.
| Compound Name | [2-[3-[(2,4-difluorophenyl)methyl]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoyl]oxidanium |
|---|---|
| PubChem CID | 163451143 |
| Molecular Formula | C26H24F5O2+ |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | [2-[3-[(2,4-difluorophenyl)methyl]-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoyl]oxidanium |
| SMILES | CC(C)CC(C(=O)[OH2+])c1cc(Cc2ccc(F)cc2F)cc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C26H23F5O2/c1-15(2)9-23(25(32)33)20-12-16(10-18-5-8-22(27)14-24(18)28)11-19(13-20)17-3-6-21(7-4-17)26(29,30)31/h3-8,11-15,23H,9-10H2,1-2H3,(H,32,33)/p+1 |
| InChIKey | BGSHELHQVPTUCL-UHFFFAOYSA-O |
| XLogP | 6.62 |
| TPSA | 39.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|