C26H22F6O — CID 59004784
5-methyl-3-[3-[4-(trifluoromethyl)phenyl]-5-(3,4,5-trifluorophenyl)phenyl]hexan-2-one (PubChem CID 59004784) has the molecular formula C26H22F6O and a molecular weight of 464.45 g/mol. Its IUPAC name is 5-methyl-3-[3-[4-(trifluoromethyl)phenyl]-5-(3,4,5-trifluorophenyl)phenyl]hexan-2-one.
| Compound Name | 5-methyl-3-[3-[4-(trifluoromethyl)phenyl]-5-(3,4,5-trifluorophenyl)phenyl]hexan-2-one |
|---|---|
| PubChem CID | 59004784 |
| Molecular Formula | C26H22F6O |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 5-methyl-3-[3-[4-(trifluoromethyl)phenyl]-5-(3,4,5-trifluorophenyl)phenyl]hexan-2-one |
| SMILES | CC(=O)C(CC(C)C)c1cc(-c2ccc(C(F)(F)F)cc2)cc(-c2cc(F)c(F)c(F)c2)c1 |
| InChI | InChI=1S/C26H22F6O/c1-14(2)8-22(15(3)33)20-10-17(16-4-6-21(7-5-16)26(30,31)32)9-18(11-20)19-12-23(27)25(29)24(28)13-19/h4-7,9-14,22H,8H2,1-3H3 |
| InChIKey | OUMZZBKBQPMPSQ-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|