C15H13F3O3S — CID 142774744
[4-methylsulfonyl-2-(trifluoromethyl)phenyl]-phenylmethanol (PubChem CID 142774744) has the molecular formula C15H13F3O3S and a molecular weight of 330.33 g/mol. Its IUPAC name is [4-methylsulfonyl-2-(trifluoromethyl)phenyl]-phenylmethanol.
| Compound Name | [4-methylsulfonyl-2-(trifluoromethyl)phenyl]-phenylmethanol |
|---|---|
| PubChem CID | 142774744 |
| Molecular Formula | C15H13F3O3S |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | [4-methylsulfonyl-2-(trifluoromethyl)phenyl]-phenylmethanol |
| SMILES | CS(=O)(=O)c1ccc(C(O)c2ccccc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H13F3O3S/c1-22(20,21)11-7-8-12(13(9-11)15(16,17)18)14(19)10-5-3-2-4-6-10/h2-9,14,19H,1H3 |
| InChIKey | FZLXUKQPSGOEPC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |