C16H10F3NO4S — CID 168518200
2-[4-methylsulfonyl-2-(trifluoromethyl)phenyl]isoindole-1,3-dione (PubChem CID 168518200) has the molecular formula C16H10F3NO4S and a molecular weight of 369.32 g/mol. Its IUPAC name is 2-[4-methylsulfonyl-2-(trifluoromethyl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-methylsulfonyl-2-(trifluoromethyl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168518200 |
| Molecular Formula | C16H10F3NO4S |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 2-[4-methylsulfonyl-2-(trifluoromethyl)phenyl]isoindole-1,3-dione |
| SMILES | CS(=O)(=O)c1ccc(N2C(=O)c3ccccc3C2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H10F3NO4S/c1-25(23,24)9-6-7-13(12(8-9)16(17,18)19)20-14(21)10-4-2-3-5-11(10)15(20)22/h2-8H,1H3 |
| InChIKey | SCILMMHNOZNVOH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|