C21H12F3NO3 — CID 168516982
2-[4-phenoxy-2-(trifluoromethyl)phenyl]isoindole-1,3-dione (PubChem CID 168516982) has the molecular formula C21H12F3NO3 and a molecular weight of 383.33 g/mol. Its IUPAC name is 2-[4-phenoxy-2-(trifluoromethyl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-phenoxy-2-(trifluoromethyl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168516982 |
| Molecular Formula | C21H12F3NO3 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 2-[4-phenoxy-2-(trifluoromethyl)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc(Oc2ccccc2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H12F3NO3/c22-21(23,24)17-12-14(28-13-6-2-1-3-7-13)10-11-18(17)25-19(26)15-8-4-5-9-16(15)20(25)27/h1-12H |
| InChIKey | WJZMCNPIDDBDGP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|