C16H12ClNO4S — CID 168518033
2-(2-chloro-3-methyl-5-methylsulfonylphenyl)isoindole-1,3-dione (PubChem CID 168518033) has the molecular formula C16H12ClNO4S and a molecular weight of 349.80 g/mol. Its IUPAC name is 2-(2-chloro-3-methyl-5-methylsulfonylphenyl)isoindole-1,3-dione.
| Compound Name | 2-(2-chloro-3-methyl-5-methylsulfonylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168518033 |
| Molecular Formula | C16H12ClNO4S |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 2-(2-chloro-3-methyl-5-methylsulfonylphenyl)isoindole-1,3-dione |
| SMILES | Cc1cc(S(C)(=O)=O)cc(N2C(=O)c3ccccc3C2=O)c1Cl |
| InChI | InChI=1S/C16H12ClNO4S/c1-9-7-10(23(2,21)22)8-13(14(9)17)18-15(19)11-5-3-4-6-12(11)16(18)20/h3-8H,1-2H3 |
| InChIKey | ZLZRJGOILBANRK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|