C23H15ClF3NO3 — CID 168516254
2-[2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)phenyl]isoindole-1,3-dione (PubChem CID 168516254) has the molecular formula C23H15ClF3NO3 and a molecular weight of 445.82 g/mol. Its IUPAC name is 2-[2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168516254 |
| Molecular Formula | C23H15ClF3NO3 |
| Molecular Weight | 445.82 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 2-[2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)phenyl]isoindole-1,3-dione |
| SMILES | Cc1cc(Oc2ccc(C(F)(F)F)cc2N2C(=O)c3ccccc3C2=O)cc(C)c1Cl |
| InChI | InChI=1S/C23H15ClF3NO3/c1-12-9-15(10-13(2)20(12)24)31-19-8-7-14(23(25,26)27)11-18(19)28-21(29)16-5-3-4-6-17(16)22(28)30/h3-11H,1-2H3 |
| InChIKey | DYEDCWWZQZYQPE-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.82 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|