C17H10F6N2O2 — CID 168517691
2-[2-(2,2,2-trifluoroethylamino)-5-(trifluoromethyl)phenyl]isoindole-1,3-dione (PubChem CID 168517691) has the molecular formula C17H10F6N2O2 and a molecular weight of 388.27 g/mol. Its IUPAC name is 2-[2-(2,2,2-trifluoroethylamino)-5-(trifluoromethyl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(2,2,2-trifluoroethylamino)-5-(trifluoromethyl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168517691 |
| Molecular Formula | C17H10F6N2O2 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 2-[2-(2,2,2-trifluoroethylamino)-5-(trifluoromethyl)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cc(C(F)(F)F)ccc1NCC(F)(F)F |
| InChI | InChI=1S/C17H10F6N2O2/c18-16(19,20)8-24-12-6-5-9(17(21,22)23)7-13(12)25-14(26)10-3-1-2-4-11(10)15(25)27/h1-7,24H,8H2 |
| InChIKey | NMRFWXUMPXVMAW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|