C28H19F3N4O4 — CID 67487141
2-[4-[3-(1,3-dioxoisoindol-2-yl)-5-(trifluoromethyl)indazol-1-yl]butyl]isoindole-1,3-dione (PubChem CID 67487141) has the molecular formula C28H19F3N4O4 and a molecular weight of 532.48 g/mol. Its IUPAC name is 2-[4-[3-(1,3-dioxoisoindol-2-yl)-5-(trifluoromethyl)indazol-1-yl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[3-(1,3-dioxoisoindol-2-yl)-5-(trifluoromethyl)indazol-1-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67487141 |
| Molecular Formula | C28H19F3N4O4 |
| Molecular Weight | 532.48 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | 2-[4-[3-(1,3-dioxoisoindol-2-yl)-5-(trifluoromethyl)indazol-1-yl]butyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCn1nc(N2C(=O)c3ccccc3C2=O)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C28H19F3N4O4/c29-28(30,31)16-11-12-22-21(15-16)23(35-26(38)19-9-3-4-10-20(19)27(35)39)32-34(22)14-6-5-13-33-24(36)17-7-1-2-8-18(17)25(33)37/h1-4,7-12,15H,5-6,13-14H2 |
| InChIKey | RZXITPOXORHQQX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|