C10H6F3IN2O2 — CID 71223421
2-[3-iodo-5-(trifluoromethyl)indazol-1-yl]acetic acid (PubChem CID 71223421) has the molecular formula C10H6F3IN2O2 and a molecular weight of 370.07 g/mol. Its IUPAC name is 2-[3-iodo-5-(trifluoromethyl)indazol-1-yl]acetic acid.
| Compound Name | 2-[3-iodo-5-(trifluoromethyl)indazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 71223421 |
| Molecular Formula | C10H6F3IN2O2 |
| Molecular Weight | 370.07 g/mol |
| Exact Mass | 369.94 |
| IUPAC Name | 2-[3-iodo-5-(trifluoromethyl)indazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1nc(I)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C10H6F3IN2O2/c11-10(12,13)5-1-2-7-6(3-5)9(14)15-16(7)4-8(17)18/h1-3H,4H2,(H,17,18) |
| InChIKey | SHXJKPHUMHENQT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.07 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|