C9H6F3N3O2 — CID 21409193
3-amino-5-(trifluoromethyl)indazole-1-carboxylic acid (PubChem CID 21409193) has the molecular formula C9H6F3N3O2 and a molecular weight of 245.16 g/mol. Its IUPAC name is 3-amino-5-(trifluoromethyl)indazole-1-carboxylic acid.
| Compound Name | 3-amino-5-(trifluoromethyl)indazole-1-carboxylic acid |
|---|---|
| PubChem CID | 21409193 |
| Molecular Formula | C9H6F3N3O2 |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 3-amino-5-(trifluoromethyl)indazole-1-carboxylic acid |
| SMILES | Nc1nn(C(=O)O)c2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C9H6F3N3O2/c10-9(11,12)4-1-2-6-5(3-4)7(13)14-15(6)8(16)17/h1-3H,(H2,13,14)(H,16,17) |
| InChIKey | PLWYOWQIDHNBDH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |