C10H8F3N3O2 — CID 54267084
methyl 3-amino-5-(trifluoromethyl)indazole-1-carboxylate (PubChem CID 54267084) has the molecular formula C10H8F3N3O2 and a molecular weight of 259.19 g/mol. Its IUPAC name is methyl 3-amino-5-(trifluoromethyl)indazole-1-carboxylate.
| Compound Name | methyl 3-amino-5-(trifluoromethyl)indazole-1-carboxylate |
|---|---|
| PubChem CID | 54267084 |
| Molecular Formula | C10H8F3N3O2 |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | methyl 3-amino-5-(trifluoromethyl)indazole-1-carboxylate |
| SMILES | COC(=O)n1nc(N)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C10H8F3N3O2/c1-18-9(17)16-7-3-2-5(10(11,12)13)4-6(7)8(14)15-16/h2-4H,1H3,(H2,14,15) |
| InChIKey | RHNHZZJVHSIFSH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |