About [3-amino-5-(trifluoromethyl)indazol-1-yl]-(2,3-dihydro-1,4-dioxin-5-yl)methanone
[3-amino-5-(trifluoromethyl)indazol-1-yl]-(2,3-dihydro-1,4-dioxin-5-yl)methanone (PubChem CID 100654511) has the molecular formula C13H10F3N3O3
and a molecular weight of 313.24 g/mol. Its IUPAC name is [3-amino-5-(trifluoromethyl)indazol-1-yl]-(2,3-dihydro-1,4-dioxin-5-yl)methanone.
Molecular Properties
| Compound Name | [3-amino-5-(trifluoromethyl)indazol-1-yl]-(2,3-dihydro-1,4-dioxin-5-yl)methanone |
| PubChem CID | 100654511 |
| Molecular Formula | C13H10F3N3O3 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | [3-amino-5-(trifluoromethyl)indazol-1-yl]-(2,3-dihydro-1,4-dioxin-5-yl)methanone |
| SMILES | Nc1nn(C(=O)C2=COCCO2)c2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C13H10F3N3O3/c14-13(15,16)7-1-2-9-8(5-7)11(17)18-19(9)12(20)10-6-21-3-4-22-10/h1-2,5-6H,3-4H2,(H2,17,18) |
| InChIKey | WQGGZVASOPCASN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-amino-5-(trifluoromethyl)indazol-1-yl]-(2,3-dihydro-1,4-dioxin-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-amino-5-(trifluoromethyl)indazol-1-yl]-(2,3-dihydro-1,4-dioxin-5-yl)methanone?
The IUPAC name of [3-amino-5-(trifluoromethyl)indazol-1-yl]-(2,3-dihydro-1,4-dioxin-5-yl)methanone (CID 100654511) is [3-amino-5-(trifluoromethyl)indazol-1-yl]-(2,3-dihydro-1,4-dioxin-5-yl)methanone.
What is the SMILES notation for [3-amino-5-(trifluoromethyl)indazol-1-yl]-(2,3-dihydro-1,4-dioxin-5-yl)methanone?
The canonical SMILES for [3-amino-5-(trifluoromethyl)indazol-1-yl]-(2,3-dihydro-1,4-dioxin-5-yl)methanone is Nc1nn(C(=O)C2=COCCO2)c2ccc(C(F)(F)F)cc12.
What is the InChIKey of [3-amino-5-(trifluoromethyl)indazol-1-yl]-(2,3-dihydro-1,4-dioxin-5-yl)methanone?
The InChIKey is WQGGZVASOPCASN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F3N3O3/c14-13(15,16)7-1-2-9-8(5-7)11(17)18-19(9)12(20)10-6-21-3-4-22-10/h1-2,5-6H,3-4H2,(H2,17,18).
What are the key properties of [3-amino-5-(trifluoromethyl)indazol-1-yl]-(2,3-dihydro-1,4-dioxin-5-yl)methanone?
[3-amino-5-(trifluoromethyl)indazol-1-yl]-(2,3-dihydro-1,4-dioxin-5-yl)methanone has a molecular weight of 313.24 g/mol, XLogP of 2.17, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-amino-5-(trifluoromethyl)indazol-1-yl]-(2,3-dihydro-1,4-dioxin-5-yl)methanone is sourced from PubChem (CID 100654511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).