C19H8F8N4O2 — CID 156877098
(2,3,4,5,6-pentafluorophenyl) 2-[4-amino-6-(trifluoromethyl)pyrimido[4,5-b]indol-9-yl]acetate (PubChem CID 156877098) has the molecular formula C19H8F8N4O2 and a molecular weight of 476.28 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-[4-amino-6-(trifluoromethyl)pyrimido[4,5-b]indol-9-yl]acetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-[4-amino-6-(trifluoromethyl)pyrimido[4,5-b]indol-9-yl]acetate |
|---|---|
| PubChem CID | 156877098 |
| Molecular Formula | C19H8F8N4O2 |
| Molecular Weight | 476.28 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-[4-amino-6-(trifluoromethyl)pyrimido[4,5-b]indol-9-yl]acetate |
| SMILES | Nc1ncnc2c1c1cc(C(F)(F)F)ccc1n2CC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H8F8N4O2/c20-11-12(21)14(23)16(15(24)13(11)22)33-9(32)4-31-8-2-1-6(19(25,26)27)3-7(8)10-17(28)29-5-30-18(10)31/h1-3,5H,4H2,(H2,28,29,30) |
| InChIKey | IYBLKXXNGKPAHE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.28 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|