About tert-butyl 2-(4-amino-7-methoxy-6-methylpyrimido[4,5-b]indol-9-yl)acetate
tert-butyl 2-(4-amino-7-methoxy-6-methylpyrimido[4,5-b]indol-9-yl)acetate (PubChem CID 156876801) has the molecular formula C18H22N4O3
and a molecular weight of 342.40 g/mol. Its IUPAC name is tert-butyl 2-(4-amino-7-methoxy-6-methylpyrimido[4,5-b]indol-9-yl)acetate.
Molecular Properties
| Compound Name | tert-butyl 2-(4-amino-7-methoxy-6-methylpyrimido[4,5-b]indol-9-yl)acetate |
| PubChem CID | 156876801 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | tert-butyl 2-(4-amino-7-methoxy-6-methylpyrimido[4,5-b]indol-9-yl)acetate |
| SMILES | COc1cc2c(cc1C)c1c(N)ncnc1n2CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H22N4O3/c1-10-6-11-12(7-13(10)24-5)22(8-14(23)25-18(2,3)4)17-15(11)16(19)20-9-21-17/h6-7,9H,8H2,1-5H3,(H2,19,20,21) |
| InChIKey | HPZMIPJOQFMXDE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl 2-(4-amino-7-methoxy-6-methylpyrimido[4,5-b]indol-9-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(4-amino-7-methoxy-6-methylpyrimido[4,5-b]indol-9-yl)acetate?
The IUPAC name of tert-butyl 2-(4-amino-7-methoxy-6-methylpyrimido[4,5-b]indol-9-yl)acetate (CID 156876801) is tert-butyl 2-(4-amino-7-methoxy-6-methylpyrimido[4,5-b]indol-9-yl)acetate.
What is the SMILES notation for tert-butyl 2-(4-amino-7-methoxy-6-methylpyrimido[4,5-b]indol-9-yl)acetate?
The canonical SMILES for tert-butyl 2-(4-amino-7-methoxy-6-methylpyrimido[4,5-b]indol-9-yl)acetate is COc1cc2c(cc1C)c1c(N)ncnc1n2CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-(4-amino-7-methoxy-6-methylpyrimido[4,5-b]indol-9-yl)acetate?
The InChIKey is HPZMIPJOQFMXDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O3/c1-10-6-11-12(7-13(10)24-5)22(8-14(23)25-18(2,3)4)17-15(11)16(19)20-9-21-17/h6-7,9H,8H2,1-5H3,(H2,19,20,21).
What are the key properties of tert-butyl 2-(4-amino-7-methoxy-6-methylpyrimido[4,5-b]indol-9-yl)acetate?
tert-butyl 2-(4-amino-7-methoxy-6-methylpyrimido[4,5-b]indol-9-yl)acetate has a molecular weight of 342.40 g/mol, XLogP of 2.83, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(4-amino-7-methoxy-6-methylpyrimido[4,5-b]indol-9-yl)acetate is sourced from PubChem (CID 156876801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).