C17H20N4O2 — CID 166518017
tert-butyl 2-(4-amino-7-methylpyrimido[4,5-b]indol-9-yl)acetate (PubChem CID 166518017) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is tert-butyl 2-(4-amino-7-methylpyrimido[4,5-b]indol-9-yl)acetate.
| Compound Name | tert-butyl 2-(4-amino-7-methylpyrimido[4,5-b]indol-9-yl)acetate |
|---|---|
| PubChem CID | 166518017 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | tert-butyl 2-(4-amino-7-methylpyrimido[4,5-b]indol-9-yl)acetate |
| SMILES | Cc1ccc2c3c(N)ncnc3n(CC(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C17H20N4O2/c1-10-5-6-11-12(7-10)21(8-13(22)23-17(2,3)4)16-14(11)15(18)19-9-20-16/h5-7,9H,8H2,1-4H3,(H2,18,19,20) |
| InChIKey | FPJXHBIQISGUSZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |