C18H17F3N2 — CID 69431115
1-butyl-3-phenyl-5-(trifluoromethyl)indazole (PubChem CID 69431115) has the molecular formula C18H17F3N2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 1-butyl-3-phenyl-5-(trifluoromethyl)indazole.
| Compound Name | 1-butyl-3-phenyl-5-(trifluoromethyl)indazole |
|---|---|
| PubChem CID | 69431115 |
| Molecular Formula | C18H17F3N2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 1-butyl-3-phenyl-5-(trifluoromethyl)indazole |
| SMILES | CCCCn1nc(-c2ccccc2)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C18H17F3N2/c1-2-3-11-23-16-10-9-14(18(19,20)21)12-15(16)17(22-23)13-7-5-4-6-8-13/h4-10,12H,2-3,11H2,1H3 |
| InChIKey | KLMUYYRAIAOBNG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |