C22H24N2O — CID 10882161
2-hexyl-5,6-diphenylpyridazin-3-one (PubChem CID 10882161) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is 2-hexyl-5,6-diphenylpyridazin-3-one.
| Compound Name | 2-hexyl-5,6-diphenylpyridazin-3-one |
|---|---|
| PubChem CID | 10882161 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 2-hexyl-5,6-diphenylpyridazin-3-one |
| SMILES | CCCCCCn1nc(-c2ccccc2)c(-c2ccccc2)cc1=O |
| InChI | InChI=1S/C22H24N2O/c1-2-3-4-11-16-24-21(25)17-20(18-12-7-5-8-13-18)22(23-24)19-14-9-6-10-15-19/h5-10,12-15,17H,2-4,11,16H2,1H3 |
| InChIKey | KIBOVPDMJDFYFZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|