C24H28N2OS — CID 10971237
6-octylsulfinyl-3,4-diphenylpyridazine (PubChem CID 10971237) has the molecular formula C24H28N2OS and a molecular weight of 392.57 g/mol. Its IUPAC name is 6-octylsulfinyl-3,4-diphenylpyridazine.
| Compound Name | 6-octylsulfinyl-3,4-diphenylpyridazine |
|---|---|
| PubChem CID | 10971237 |
| Molecular Formula | C24H28N2OS |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 6-octylsulfinyl-3,4-diphenylpyridazine |
| SMILES | CCCCCCCCS(=O)c1cc(-c2ccccc2)c(-c2ccccc2)nn1 |
| InChI | InChI=1S/C24H28N2OS/c1-2-3-4-5-6-13-18-28(27)23-19-22(20-14-9-7-10-15-20)24(26-25-23)21-16-11-8-12-17-21/h7-12,14-17,19H,2-6,13,18H2,1H3 |
| InChIKey | NVGVTYCODIVMOY-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|