About 6-methyl-3,4-diphenylpyridazine
6-methyl-3,4-diphenylpyridazine (PubChem CID 6411990) has the molecular formula C17H14N2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 6-methyl-3,4-diphenylpyridazine.
Molecular Properties
| Compound Name | 6-methyl-3,4-diphenylpyridazine |
| PubChem CID | 6411990 |
| Molecular Formula | C17H14N2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 6-methyl-3,4-diphenylpyridazine |
| SMILES | Cc1cc(-c2ccccc2)c(-c2ccccc2)nn1 |
| InChI | InChI=1S/C17H14N2/c1-13-12-16(14-8-4-2-5-9-14)17(19-18-13)15-10-6-3-7-11-15/h2-12H,1H3 |
| InChIKey | RRQBBOGLPGLHMY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-3,4-diphenylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3,4-diphenylpyridazine?
The IUPAC name of 6-methyl-3,4-diphenylpyridazine (CID 6411990) is 6-methyl-3,4-diphenylpyridazine.
What is the SMILES notation for 6-methyl-3,4-diphenylpyridazine?
The canonical SMILES for 6-methyl-3,4-diphenylpyridazine is Cc1cc(-c2ccccc2)c(-c2ccccc2)nn1.
What is the InChIKey of 6-methyl-3,4-diphenylpyridazine?
The InChIKey is RRQBBOGLPGLHMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2/c1-13-12-16(14-8-4-2-5-9-14)17(19-18-13)15-10-6-3-7-11-15/h2-12H,1H3.
What are the key properties of 6-methyl-3,4-diphenylpyridazine?
6-methyl-3,4-diphenylpyridazine has a molecular weight of 246.31 g/mol, XLogP of 4.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3,4-diphenylpyridazine is sourced from PubChem (CID 6411990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).