C17H14N2 — CID 6411990
6-methyl-3,4-diphenylpyridazine (PubChem CID 6411990) has the molecular formula C17H14N2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 6-methyl-3,4-diphenylpyridazine.
| Compound Name | 6-methyl-3,4-diphenylpyridazine |
|---|---|
| PubChem CID | 6411990 |
| Molecular Formula | C17H14N2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 6-methyl-3,4-diphenylpyridazine |
| SMILES | Cc1cc(-c2ccccc2)c(-c2ccccc2)nn1 |
| InChI | InChI=1S/C17H14N2/c1-13-12-16(14-8-4-2-5-9-14)17(19-18-13)15-10-6-3-7-11-15/h2-12H,1H3 |
| InChIKey | RRQBBOGLPGLHMY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |