C20H21NSi — CID 140739470
(5,6-diphenyl-3-pyridinyl)-trimethylsilane (PubChem CID 140739470) has the molecular formula C20H21NSi and a molecular weight of 303.48 g/mol. Its IUPAC name is (5,6-diphenyl-3-pyridinyl)-trimethylsilane.
| Compound Name | (5,6-diphenyl-3-pyridinyl)-trimethylsilane |
|---|---|
| PubChem CID | 140739470 |
| Molecular Formula | C20H21NSi |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (5,6-diphenyl-3-pyridinyl)-trimethylsilane |
| SMILES | C[Si](C)(C)c1cnc(-c2ccccc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C20H21NSi/c1-22(2,3)18-14-19(16-10-6-4-7-11-16)20(21-15-18)17-12-8-5-9-13-17/h4-15H,1-3H3 |
| InChIKey | YUPAIHYCYDAVCD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|