C20H26N2OSi2 — CID 172541927
trimethyl-[6-phenyl-5-(4-trimethylsilyl-1,3-oxazol-2-yl)-3-pyridinyl]silane (PubChem CID 172541927) has the molecular formula C20H26N2OSi2 and a molecular weight of 366.61 g/mol. Its IUPAC name is trimethyl-[6-phenyl-5-(4-trimethylsilyl-1,3-oxazol-2-yl)-3-pyridinyl]silane.
| Compound Name | trimethyl-[6-phenyl-5-(4-trimethylsilyl-1,3-oxazol-2-yl)-3-pyridinyl]silane |
|---|---|
| PubChem CID | 172541927 |
| Molecular Formula | C20H26N2OSi2 |
| Molecular Weight | 366.61 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | trimethyl-[6-phenyl-5-(4-trimethylsilyl-1,3-oxazol-2-yl)-3-pyridinyl]silane |
| SMILES | C[Si](C)(C)c1cnc(-c2ccccc2)c(-c2nc([Si](C)(C)C)co2)c1 |
| InChI | InChI=1S/C20H26N2OSi2/c1-24(2,3)16-12-17(20-22-18(14-23-20)25(4,5)6)19(21-13-16)15-10-8-7-9-11-15/h7-14H,1-6H3 |
| InChIKey | PHUUAIKXLSKGIO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|