C41H34N4Si — CID 176645518
[5-[3-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-2-pyridinyl]-trimethylsilane (PubChem CID 176645518) has the molecular formula C41H34N4Si and a molecular weight of 610.84 g/mol. Its IUPAC name is [5-[3-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-2-pyridinyl]-trimethylsilane.
| Compound Name | [5-[3-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-2-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 176645518 |
| Molecular Formula | C41H34N4Si |
| Molecular Weight | 610.84 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | [5-[3-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-2-pyridinyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2cccc(-c3cccc(-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)c3)c2)cn1 |
| InChI | InChI=1S/C41H34N4Si/c1-46(2,3)38-24-23-37(28-42-38)35-21-11-19-33(26-35)31-17-10-18-32(25-31)34-20-12-22-36(27-34)41-44-39(29-13-6-4-7-14-29)43-40(45-41)30-15-8-5-9-16-30/h4-28H,1-3H3 |
| InChIKey | HZYSOIGRSUYMOK-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.84 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|