C21H29NSi — CID 140739408
[5-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane (PubChem CID 140739408) has the molecular formula C21H29NSi and a molecular weight of 323.56 g/mol. Its IUPAC name is [5-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane.
| Compound Name | [5-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 140739408 |
| Molecular Formula | C21H29NSi |
| Molecular Weight | 323.56 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | [5-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1cnc(-c2ccccc2)c(CC2CCCCC2)c1 |
| InChI | InChI=1S/C21H29NSi/c1-23(2,3)20-15-19(14-17-10-6-4-7-11-17)21(22-16-20)18-12-8-5-9-13-18/h5,8-9,12-13,15-17H,4,6-7,10-11,14H2,1-3H3 |
| InChIKey | OIHIALGZXWTDTO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|