C19H29NOSi — CID 174111514
3-[4-(cyclohexylmethyl)-5-trimethylsilyl-2-pyridinyl]buta-1,3-dien-2-ol (PubChem CID 174111514) has the molecular formula C19H29NOSi and a molecular weight of 315.53 g/mol. Its IUPAC name is 3-[4-(cyclohexylmethyl)-5-trimethylsilyl-2-pyridinyl]buta-1,3-dien-2-ol.
| Compound Name | 3-[4-(cyclohexylmethyl)-5-trimethylsilyl-2-pyridinyl]buta-1,3-dien-2-ol |
|---|---|
| PubChem CID | 174111514 |
| Molecular Formula | C19H29NOSi |
| Molecular Weight | 315.53 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 3-[4-(cyclohexylmethyl)-5-trimethylsilyl-2-pyridinyl]buta-1,3-dien-2-ol |
| SMILES | C=C(O)C(=C)c1cc(CC2CCCCC2)c([Si](C)(C)C)cn1 |
| InChI | InChI=1S/C19H29NOSi/c1-14(15(2)21)18-12-17(11-16-9-7-6-8-10-16)19(13-20-18)22(3,4)5/h12-13,16,21H,1-2,6-11H2,3-5H3 |
| InChIKey | ORCNAWLSACEOFW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|