C23H32IrNSi- — CID 154591950
[4-(cyclopentylmethyl)-6-(3-propan-2-ylbenzene-6-id-1-yl)-3-pyridinyl]-trimethylsilane;iridium (PubChem CID 154591950) has the molecular formula C23H32IrNSi- and a molecular weight of 542.82 g/mol. Its IUPAC name is [4-(cyclopentylmethyl)-6-(3-propan-2-ylbenzene-6-id-1-yl)-3-pyridinyl]-trimethylsilane;iridium.
| Compound Name | [4-(cyclopentylmethyl)-6-(3-propan-2-ylbenzene-6-id-1-yl)-3-pyridinyl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 154591950 |
| Molecular Formula | C23H32IrNSi- |
| Molecular Weight | 542.82 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | [4-(cyclopentylmethyl)-6-(3-propan-2-ylbenzene-6-id-1-yl)-3-pyridinyl]-trimethylsilane;iridium |
| SMILES | CC(C)c1cc[c-]c(-c2cc(CC3CCCC3)c([Si](C)(C)C)cn2)c1.[Ir] |
| InChI | InChI=1S/C23H32NSi.Ir/c1-17(2)19-11-8-12-20(14-19)22-15-21(13-18-9-6-7-10-18)23(16-24-22)25(3,4)5;/h8,11,14-18H,6-7,9-10,13H2,1-5H3;/q-1; |
| InChIKey | MIUDOCLWOUDYND-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.82 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|