C48H50IrN2SSi-2 — CID 166578726
[4-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium;4-(2-methylpropyl)-2-(1-phenyl-4H-dibenzothiophen-4-id-3-yl)pyridine (PubChem CID 166578726) has the molecular formula C48H50IrN2SSi-2 and a molecular weight of 907.31 g/mol. Its IUPAC name is [4-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium;4-(2-methylpropyl)-2-(1-phenyl-4H-dibenzothiophen-4-id-3-yl)pyridine.
| Compound Name | [4-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium;4-(2-methylpropyl)-2-(1-phenyl-4H-dibenzothiophen-4-id-3-yl)pyridine |
|---|---|
| PubChem CID | 166578726 |
| Molecular Formula | C48H50IrN2SSi-2 |
| Molecular Weight | 907.31 g/mol |
| Exact Mass | 907.31 |
| IUPAC Name | [4-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium;4-(2-methylpropyl)-2-(1-phenyl-4H-dibenzothiophen-4-id-3-yl)pyridine |
| SMILES | CC(C)Cc1ccnc(-c2[c-]c3sc4ccccc4c3c(-c3ccccc3)c2)c1.C[Si](C)(C)c1cnc(-c2[c-]cccc2)cc1CC1CCCCC1.[Ir] |
| InChI | InChI=1S/C27H22NS.C21H28NSi.Ir/c1-18(2)14-19-12-13-28-24(15-19)21-16-23(20-8-4-3-5-9-20)27-22-10-6-7-11-25(22)29-26(27)17-21;1-23(2,3)21-16-22-20(18-12-8-5-9-13-18)15-19(21)14-17-10-6-4-7-11-17;/h3-13,15-16,18H,14H2,1-2H3;5,8-9,12,15-17H,4,6-7,10-11,14H2,1-3H3;/q2*-1; |
| InChIKey | ISEOTKBAPVDYMV-UHFFFAOYSA-N |
| XLogP | 13.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.31 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|