C28H36N2Si — CID 166576367
[4-(cyclohexylmethyl)-6-[4-(2,6-dimethyl-4-pyridinyl)phenyl]-3-pyridinyl]-trimethylsilane (PubChem CID 166576367) has the molecular formula C28H36N2Si and a molecular weight of 428.70 g/mol. Its IUPAC name is [4-(cyclohexylmethyl)-6-[4-(2,6-dimethyl-4-pyridinyl)phenyl]-3-pyridinyl]-trimethylsilane.
| Compound Name | [4-(cyclohexylmethyl)-6-[4-(2,6-dimethyl-4-pyridinyl)phenyl]-3-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 166576367 |
| Molecular Formula | C28H36N2Si |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | [4-(cyclohexylmethyl)-6-[4-(2,6-dimethyl-4-pyridinyl)phenyl]-3-pyridinyl]-trimethylsilane |
| SMILES | Cc1cc(-c2ccc(-c3cc(CC4CCCCC4)c([Si](C)(C)C)cn3)cc2)cc(C)n1 |
| InChI | InChI=1S/C28H36N2Si/c1-20-15-25(16-21(2)30-20)23-11-13-24(14-12-23)27-18-26(17-22-9-7-6-8-10-22)28(19-29-27)31(3,4)5/h11-16,18-19,22H,6-10,17H2,1-5H3 |
| InChIKey | VQAPKBXKXROMSI-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|