C25H31NSi — CID 155612262
[4-(1,1-dideuterio-2,2-dimethylpropyl)-6-(4-phenylphenyl)-3-pyridinyl]-trimethylsilane (PubChem CID 155612262) has the molecular formula C25H31NSi and a molecular weight of 375.63 g/mol. Its IUPAC name is [4-(1,1-dideuterio-2,2-dimethylpropyl)-6-(4-phenylphenyl)-3-pyridinyl]-trimethylsilane.
| Compound Name | [4-(1,1-dideuterio-2,2-dimethylpropyl)-6-(4-phenylphenyl)-3-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 155612262 |
| Molecular Formula | C25H31NSi |
| Molecular Weight | 375.63 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | [4-(1,1-dideuterio-2,2-dimethylpropyl)-6-(4-phenylphenyl)-3-pyridinyl]-trimethylsilane |
| SMILES | [2H]C([2H])(c1cc(-c2ccc(-c3ccccc3)cc2)ncc1[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C25H31NSi/c1-25(2,3)17-22-16-23(26-18-24(22)27(4,5)6)21-14-12-20(13-15-21)19-10-8-7-9-11-19/h7-16,18H,17H2,1-6H3/i17D2 |
| InChIKey | WCVSOPHAUHALLD-FBCWWBABSA-N |
| XLogP | 6.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.63 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|