C27H31GeN — CID 164792226
[4-(1,1-dideuterio-2,2-dimethylpropyl)-6-phenanthren-2-yl-3-pyridinyl]-trimethylgermane (PubChem CID 164792226) has the molecular formula C27H31GeN and a molecular weight of 444.17 g/mol. Its IUPAC name is [4-(1,1-dideuterio-2,2-dimethylpropyl)-6-phenanthren-2-yl-3-pyridinyl]-trimethylgermane.
| Compound Name | [4-(1,1-dideuterio-2,2-dimethylpropyl)-6-phenanthren-2-yl-3-pyridinyl]-trimethylgermane |
|---|---|
| PubChem CID | 164792226 |
| Molecular Formula | C27H31GeN |
| Molecular Weight | 444.17 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | [4-(1,1-dideuterio-2,2-dimethylpropyl)-6-phenanthren-2-yl-3-pyridinyl]-trimethylgermane |
| SMILES | [2H]C([2H])(c1cc(-c2ccc3c(ccc4ccccc43)c2)ncc1[Ge](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C27H31GeN/c1-27(2,3)17-22-16-26(29-18-25(22)28(4,5)6)21-13-14-24-20(15-21)12-11-19-9-7-8-10-23(19)24/h7-16,18H,17H2,1-6H3/i17D2 |
| InChIKey | LYOVZWUQMCVEQN-FBCWWBABSA-N |
| XLogP | 7.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.17 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|