C21H31GeN — CID 156658626
[4-(2-ethyl-2-methylbutyl)-6-phenyl-3-pyridinyl]-trimethylgermane (PubChem CID 156658626) has the molecular formula C21H31GeN and a molecular weight of 370.10 g/mol. Its IUPAC name is [4-(2-ethyl-2-methylbutyl)-6-phenyl-3-pyridinyl]-trimethylgermane.
| Compound Name | [4-(2-ethyl-2-methylbutyl)-6-phenyl-3-pyridinyl]-trimethylgermane |
|---|---|
| PubChem CID | 156658626 |
| Molecular Formula | C21H31GeN |
| Molecular Weight | 370.10 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [4-(2-ethyl-2-methylbutyl)-6-phenyl-3-pyridinyl]-trimethylgermane |
| SMILES | CCC(C)(CC)Cc1cc(-c2ccccc2)ncc1[Ge](C)(C)C |
| InChI | InChI=1S/C21H31GeN/c1-7-21(3,8-2)15-18-14-20(17-12-10-9-11-13-17)23-16-19(18)22(4,5)6/h9-14,16H,7-8,15H2,1-6H3 |
| InChIKey | YCXHTYYXQOIWBX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.10 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |