C21H29GeN — CID 155611079
[4-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylgermane (PubChem CID 155611079) has the molecular formula C21H29GeN and a molecular weight of 368.08 g/mol. Its IUPAC name is [4-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylgermane.
| Compound Name | [4-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylgermane |
|---|---|
| PubChem CID | 155611079 |
| Molecular Formula | C21H29GeN |
| Molecular Weight | 368.08 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | [4-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylgermane |
| SMILES | C[Ge](C)(C)c1cnc(-c2ccccc2)cc1CC1CCCCC1 |
| InChI | InChI=1S/C21H29GeN/c1-22(2,3)20-16-23-21(18-12-8-5-9-13-18)15-19(20)14-17-10-6-4-7-11-17/h5,8-9,12-13,15-17H,4,6-7,10-11,14H2,1-3H3 |
| InChIKey | RANPKRGXDSPSIO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.08 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |