C25H31NSi — CID 140739178
trimethyl-[4-pentyl-6-(3-phenylphenyl)-3-pyridinyl]silane (PubChem CID 140739178) has the molecular formula C25H31NSi and a molecular weight of 373.62 g/mol. Its IUPAC name is trimethyl-[4-pentyl-6-(3-phenylphenyl)-3-pyridinyl]silane.
| Compound Name | trimethyl-[4-pentyl-6-(3-phenylphenyl)-3-pyridinyl]silane |
|---|---|
| PubChem CID | 140739178 |
| Molecular Formula | C25H31NSi |
| Molecular Weight | 373.62 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | trimethyl-[4-pentyl-6-(3-phenylphenyl)-3-pyridinyl]silane |
| SMILES | CCCCCc1cc(-c2cccc(-c3ccccc3)c2)ncc1[Si](C)(C)C |
| InChI | InChI=1S/C25H31NSi/c1-5-6-8-14-23-18-24(26-19-25(23)27(2,3)4)22-16-11-15-21(17-22)20-12-9-7-10-13-20/h7,9-13,15-19H,5-6,8,14H2,1-4H3 |
| InChIKey | INCVPCDAPXJEDV-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.62 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|