C23H25NSSi — CID 140751261
(6-dibenzothiophen-2-yl-4-propyl-3-pyridinyl)-trimethylsilane (PubChem CID 140751261) has the molecular formula C23H25NSSi and a molecular weight of 375.61 g/mol. Its IUPAC name is (6-dibenzothiophen-2-yl-4-propyl-3-pyridinyl)-trimethylsilane.
| Compound Name | (6-dibenzothiophen-2-yl-4-propyl-3-pyridinyl)-trimethylsilane |
|---|---|
| PubChem CID | 140751261 |
| Molecular Formula | C23H25NSSi |
| Molecular Weight | 375.61 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (6-dibenzothiophen-2-yl-4-propyl-3-pyridinyl)-trimethylsilane |
| SMILES | CCCc1cc(-c2ccc3sc4ccccc4c3c2)ncc1[Si](C)(C)C |
| InChI | InChI=1S/C23H25NSSi/c1-5-8-17-14-20(24-15-23(17)26(2,3)4)16-11-12-22-19(13-16)18-9-6-7-10-21(18)25-22/h6-7,9-15H,5,8H2,1-4H3 |
| InChIKey | JSPJNINCCDCUNY-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.61 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|