C25H19NS — CID 162708265
2-dibenzothiophen-2-yl-4-[dideuterio(phenyl)methyl]-5-(trideuteriomethyl)pyridine (PubChem CID 162708265) has the molecular formula C25H19NS and a molecular weight of 370.53 g/mol. Its IUPAC name is 2-dibenzothiophen-2-yl-4-[dideuterio(phenyl)methyl]-5-(trideuteriomethyl)pyridine.
| Compound Name | 2-dibenzothiophen-2-yl-4-[dideuterio(phenyl)methyl]-5-(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 162708265 |
| Molecular Formula | C25H19NS |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-dibenzothiophen-2-yl-4-[dideuterio(phenyl)methyl]-5-(trideuteriomethyl)pyridine |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2ccc3sc4ccccc4c3c2)cc1C([2H])([2H])c1ccccc1 |
| InChI | InChI=1S/C25H19NS/c1-17-16-26-23(15-20(17)13-18-7-3-2-4-8-18)19-11-12-25-22(14-19)21-9-5-6-10-24(21)27-25/h2-12,14-16H,13H2,1H3/i1D3,13D2 |
| InChIKey | ZGPOXLRAORAYEZ-HGSMBRELSA-N |
| XLogP | 7.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |