C20H19N — CID 162709845
2-[3-[dideuterio(phenyl)methyl]-4-(trideuteriomethyl)phenyl]-4-(trideuteriomethyl)pyridine (PubChem CID 162709845) has the molecular formula C20H19N and a molecular weight of 281.43 g/mol. Its IUPAC name is 2-[3-[dideuterio(phenyl)methyl]-4-(trideuteriomethyl)phenyl]-4-(trideuteriomethyl)pyridine.
| Compound Name | 2-[3-[dideuterio(phenyl)methyl]-4-(trideuteriomethyl)phenyl]-4-(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 162709845 |
| Molecular Formula | C20H19N |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 2-[3-[dideuterio(phenyl)methyl]-4-(trideuteriomethyl)phenyl]-4-(trideuteriomethyl)pyridine |
| SMILES | [2H]C([2H])([2H])c1ccnc(-c2ccc(C([2H])([2H])[2H])c(C([2H])([2H])c3ccccc3)c2)c1 |
| InChI | InChI=1S/C20H19N/c1-15-10-11-21-20(12-15)18-9-8-16(2)19(14-18)13-17-6-4-3-5-7-17/h3-12,14H,13H2,1-2H3/i1D3,2D3,13D2 |
| InChIKey | UJZBBBSYECQPLG-WKGGBBDHSA-N |
| XLogP | 4.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |