C19H17N — CID 162707478
2-[3-[dideuterio(phenyl)methyl]-4-(trideuteriomethyl)phenyl]pyridine (PubChem CID 162707478) has the molecular formula C19H17N and a molecular weight of 264.38 g/mol. Its IUPAC name is 2-[3-[dideuterio(phenyl)methyl]-4-(trideuteriomethyl)phenyl]pyridine.
| Compound Name | 2-[3-[dideuterio(phenyl)methyl]-4-(trideuteriomethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 162707478 |
| Molecular Formula | C19H17N |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-[3-[dideuterio(phenyl)methyl]-4-(trideuteriomethyl)phenyl]pyridine |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2ccccn2)cc1C([2H])([2H])c1ccccc1 |
| InChI | InChI=1S/C19H17N/c1-15-10-11-17(19-9-5-6-12-20-19)14-18(15)13-16-7-3-2-4-8-16/h2-12,14H,13H2,1H3/i1D3,13D2 |
| InChIKey | SCJQDPMWFZHJAJ-HGSMBRELSA-N |
| XLogP | 4.65 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |