C18H16N2 — CID 153412508
4-(1,1,2,2,2-pentadeuterioethyl)-2-(3-pyridin-2-ylphenyl)pyridine (PubChem CID 153412508) has the molecular formula C18H16N2 and a molecular weight of 265.37 g/mol. Its IUPAC name is 4-(1,1,2,2,2-pentadeuterioethyl)-2-(3-pyridin-2-ylphenyl)pyridine.
| Compound Name | 4-(1,1,2,2,2-pentadeuterioethyl)-2-(3-pyridin-2-ylphenyl)pyridine |
|---|---|
| PubChem CID | 153412508 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 4-(1,1,2,2,2-pentadeuterioethyl)-2-(3-pyridin-2-ylphenyl)pyridine |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])c1ccnc(-c2cccc(-c3ccccn3)c2)c1 |
| InChI | InChI=1S/C18H16N2/c1-2-14-9-11-20-18(12-14)16-7-5-6-15(13-16)17-8-3-4-10-19-17/h3-13H,2H2,1H3/i1D3,2D2 |
| InChIKey | CLHMKOKXQDDLKP-ZBJDZAJPSA-N |
| XLogP | 4.37 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |