C19H16N2S — CID 122382956
4-([1]benzothiolo[2,3-c]pyridin-3-yl)-N,N-dimethylaniline (PubChem CID 122382956) has the molecular formula C19H16N2S and a molecular weight of 304.42 g/mol. Its IUPAC name is 4-([1]benzothiolo[2,3-c]pyridin-3-yl)-N,N-dimethylaniline.
| Compound Name | 4-([1]benzothiolo[2,3-c]pyridin-3-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 122382956 |
| Molecular Formula | C19H16N2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 4-([1]benzothiolo[2,3-c]pyridin-3-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2cc3c(cn2)sc2ccccc23)cc1 |
| InChI | InChI=1S/C19H16N2S/c1-21(2)14-9-7-13(8-10-14)17-11-16-15-5-3-4-6-18(15)22-19(16)12-20-17/h3-12H,1-2H3 |
| InChIKey | CSTOXLNNYFLDMQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |